On Target NS5B_HCV2A 0.40703517/CHEMBL3127326
For the given ligand HAF-2, we have found in our database that, being scored 0.40703517, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| HAF-2 (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| C=CC4CN3CCC2c1c(cccc1OC)NC2C3CC4/C(=C/OC)C(=O)OC | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00014002 89000208 2010012a 14010700 20081000 00002041 03080000 20001600 11200800 00388ac8 08300004 504390c0 8400801a 09a02000 03020541 000c200a 90a6c080 02000000 08452018 00022601 40100100 38200a10 21000001 83500413 00000000 c0000000 00001000 90001080 0c08c302 0006c00a 24028080 20022610 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |