On Target E2_HCV77 0.27598566/CHEMBL3892606
For the given ligand HAF-1, we have found in our database that, being scored 0.27598566, the most similar ligand is CHEMBL3892606. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL3892606 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | CC(C)c1ccc2c(Nc3cc(C(=O)Nc4ccc(-c5c[nH]c([C@@H]6CCCN6C(=O)Cc6ccccc6)n5)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 1000c00a 01803a00 001a4d00 18190e10 04040060 0810601a 01409010 22083841 10802180 000808d0 08399004 6081d800 07008882 08918000 40020040 9a0c0106 04069000 76006023 0c60000a 52200a01 c1300000 182f8660 21816040 8158001f 00144001 80080200 022082d8 908010c0 2441c30c 01e60803 c004a8a0 200126e0 |