On Target NS5B_HCV1A 0.304/CHEMBL3644912
For the given ligand HAF-1, we have found in our database that, being scored 0.304, the most similar ligand is CHEMBL3644912. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL3644912 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(C3CCCCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 00014086 0d403c00 00100122 45310f00 20080000 00018000 000a0004 a0003409 10800a00 005a8be8 08302404 5001b000 0e00f002 0124a101 80420440 001a8008 02864010 02482000 4a612850 00004a01 60100100 bc050e10 21020003 3244003a 02112000 80001002 00000000 902000ac 08008202 81060093 a41a4000 01016670 |