On Target NS5B_HCV1B 0.34439835/CHEMBL3645206
For the given ligand HAF-1, we have found in our database that, being scored 0.34439835, the most similar ligand is CHEMBL3645206. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL3645206 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | CNC(=O)c1c2cc(C3CC3)c(N(CCCO)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 00004006 0080de08 20180902 41310e00 210c0000 00004042 02040000 02001408 00100900 004908c0 09312024 40118800 80008c33 01400201 810a0040 000e200e 04268000 02400004 08e00008 00224205 c0100101 1c838e38 2180c880 9360001c 02104080 c0000040 00270080 8000108c 0c488104 0046004b c4048088 a81147e0 |