On Target PR_SARS 0.26262626/CHEMBL2441741
For the given ligand HAF-1, we have found in our database that, being scored 0.26262626, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |