On Target NP_HCoV-OC43 0.14857143/CHEMBL3233481
For the given ligand HAF-1, we have found in our database that, being scored 0.14857143, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |