On Target PLP_SARS 0.2927928/CHEMBL365134
For the given ligand HAF-1, we have found in our database that, being scored 0.2927928, the most similar ligand is CHEMBL365134. Check out the elaboration below.
| HAF-1 (Given Ligand) | CHEMBL365134 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC13CCN(C)C1N(CC(O)C(C)(C)O)c2cc(Br)ccc23 | O=C1C(=O)N(Cc2cc3ccccc3s2)c2c(Br)cccc21 |
|
|
|
|
|
|
| 00004016 01008200 00101110 00110e00 20000080 00002052 02000004 20002501 f0200880 001808c2 08300005 40038000 00021012 00000000 000a0540 000c000a 3004c000 02400420 08810058 00010241 40100100 18210000 27028080 81500011 00111003 80000000 08524000 90001080 04088000 0006080a 04080088 28016600 | 1001c002 15c08800 02100100 00010600 300c8000 00010040 00000080 02085002 44810080 000808c0 08280204 c001f080 03008812 00100020 c00225c0 00000000 00049000 0200000c 08204000 00000209 c0101400 58228689 20012080 8144001d 02000022 c4010282 00020010 80001084 05088300 00062003 a0047008 28c10600 |