On Target PLP_SARS 0.30243903/CHEMBL358279
For the given ligand HAF-2, we have found in our database that, being scored 0.30243903, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| HAF-2 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| C=CC4CN3CCC2c1c(cccc1OC)NC2C3CC4/C(=C/OC)C(=O)OC | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00014002 89000208 2010012a 14010700 20081000 00002041 03080000 20001600 11200800 00388ac8 08300004 504390c0 8400801a 09a02000 03020541 000c200a 90a6c080 02000000 08452018 00022601 40100100 38200a10 21000001 83500413 00000000 c0000000 00001000 90001080 0c08c302 0006c00a 24028080 20022610 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |