On Target PR_FCoV 0.29761904/CHEMBL4214066
For the given ligand m, we have found in our database that, being scored 0.29761904, the most similar ligand is CHEMBL4214066. Check out the elaboration below.
| m (Given Ligand) | CHEMBL4214066 (Similar Ligand) |
|---|---|
| COc5ccc(N(C(=O)c2ccc(c1ccccc1)cc2)C4(C(=O)NCc3ccccc3)CCOCC4)cc5 | CC(C)C[C@H](NC(=O)OC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0004e002 01803808 20100128 44010700 a0181000 00000000 02000000 22001008 00000100 00010ac0 00280004 4001f000 86008822 00182000 01020441 00081008 00260000 02000100 0cc00000 10020201 c0100020 38128600 31012080 0240001e 00000401 c0000080 00040200 900000c0 0800c300 00060001 a0045000 00000a00 | 00030000 01403000 00100100 04010600 00000000 00018010 00000001 20000008 00a00200 00020080 00200000 5003b000 0e00801a 00002101 80000000 001a0008 00220000 00080000 00802810 00000201 00000000 30140f70 01000081 02100018 00000001 00001002 00000000 10200020 08000200 00040005 a0004000 00802200 |