On Target PA_INFA 0.31730768/CHEMBL4513495
For the given ligand m, we have found in our database that, being scored 0.31730768, the most similar ligand is CHEMBL4513495. Check out the elaboration below.
| m (Given Ligand) | CHEMBL4513495 (Similar Ligand) |
|---|---|
| COc5ccc(N(C(=O)c2ccc(c1ccccc1)cc2)C4(C(=O)NCc3ccccc3)CCOCC4)cc5 | CN1C[C@H](C(c2ccccc2)c2ccccc2)n2ccc(=O)c(O)c2C1=O |
|
|
|
|
|
|
| 0004e002 01803808 20100128 44010700 a0181000 00000000 02000000 22001008 00000100 00010ac0 00280004 4001f000 86008822 00182000 01020441 00081008 00260000 02000100 0cc00000 10020201 c0100020 38128600 31012080 0240001e 00000401 c0000080 00040200 900000c0 0800c300 00060001 a0045000 00000a00 | 00000002 00003e08 70104100 50010e00 00040028 00120044 0c000000 23203401 02300800 801908c0 08390004 40018000 00009806 00500000 00020c00 0204210c 00004000 02004002 00200000 00060201 40000101 382f8610 20802000 c350001c 08112400 e0000080 00400060 d0040000 0c040184 0406001b a40c0000 40004600 |