On Target DPM_HHV1K 0.26254827/CHEMBL479371
For the given ligand m, we have found in our database that, being scored 0.26254827, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| m (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| COc5ccc(N(C(=O)c2ccc(c1ccccc1)cc2)C4(C(=O)NCc3ccccc3)CCOCC4)cc5 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 0004e002 01803808 20100128 44010700 a0181000 00000000 02000000 22001008 00000100 00010ac0 00280004 4001f000 86008822 00182000 01020441 00081008 00260000 02000100 0cc00000 10020201 c0100020 38128600 31012080 0240001e 00000401 c0000080 00040200 900000c0 0800c300 00060001 a0045000 00000a00 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |