On Target PR_SARS 0.27513227/CHEMBL2441741
For the given ligand m, we have found in our database that, being scored 0.27513227, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| m (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| COc5ccc(N(C(=O)c2ccc(c1ccccc1)cc2)C4(C(=O)NCc3ccccc3)CCOCC4)cc5 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0004e002 01803808 20100128 44010700 a0181000 00000000 02000000 22001008 00000100 00010ac0 00280004 4001f000 86008822 00182000 01020441 00081008 00260000 02000100 0cc00000 10020201 c0100020 38128600 31012080 0240001e 00000401 c0000080 00040200 900000c0 0800c300 00060001 a0045000 00000a00 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |