On Target NS3_HCV1A 0.33887044/CHEMBL3984605
For the given ligand Tar2023, we have found in our database that, being scored 0.33887044, the most similar ligand is CHEMBL3984605. Check out the elaboration below.
| Tar2023 (Given Ligand) | CHEMBL3984605 (Similar Ligand) |
|---|---|
| Cc3nn(c1ccc(Cl)cc1)c4O/C(O)=C(C#N)\C(c2ccc(Br)cc2Br)c34 | CC[C@@H](N[C@@H](C)CC(N)=O)c1ccc(Cl)c(C(=O)c2ccc(-n3cc(CO)cn3)nc2)c1F |
|
|
|
|
|
|
| 0040c40e 4a008618 60080388 00810618 010c0820 40a04006 02002401 09281600 80240b04 001908c0 19b00004 4000aa40 82004814 20200000 6b820a40 0a3c200c 00410400 82900e0a 00580100 00a60101 c0040100 38018528 20804c80 8f4a0414 00002c04 c0000041 001a0040 70000800 07084b84 1056045a 77060008 8a4204f8 | 080080c6 40805e08 20104180 c2050610 400c5201 0000c010 30002400 03001000 00c08b00 00090fd0 09320004 4000ba00 8e008866 08001004 00000500 080c000c 03018200 83800004 01680510 00220201 c5000520 1c078720 a1800802 b360001c 00143000 e0000200 08040080 d0800981 04400188 1046801a e4040000 80026ea0 |