On Target PA_INFA 0.3147541/CHEMBL4439208
For the given ligand Tar2023, we have found in our database that, being scored 0.3147541, the most similar ligand is CHEMBL4439208. Check out the elaboration below.
| Tar2023 (Given Ligand) | CHEMBL4439208 (Similar Ligand) |
|---|---|
| Cc3nn(c1ccc(Cl)cc1)c4O/C(O)=C(C#N)\C(c2ccc(Br)cc2Br)c34 | COCCN1C[C@H](C(c2ccccc2)c2ccccc2)n2cc(C(=O)O)c(=O)c(O)c2C1=O |
|
|
|
|
|
|
| 0040c40e 4a008618 60080388 00810618 010c0820 40a04006 02002401 09281600 80240b04 001908c0 19b00004 4000aa40 82004814 20200000 6b820a40 0a3c200c 00410400 82900e0a 00580100 00a60101 c0040100 38018528 20804c80 8f4a0414 00002c04 c0000041 001a0040 70000800 07084b84 1056045a 77060008 8a4204f8 | 0000001a 4880fe08 70104100 50050e10 040410aa 0012c144 0c000000 23203401 02300900 801908d0 08390004 40018000 80009806 08500000 001a1c80 2a0c210c 10004000 82004006 00200000 00060201 c0000121 382f8e50 32802000 c350001c 08152400 e0000080 08c00060 d0040001 0c440384 0406005b e40c0000 40004600 |