On Target PR_HIV1 0.20132013/CHEMBL503401
For the given ligand Tar2023, we have found in our database that, being scored 0.20132013, the most similar ligand is CHEMBL503401. Check out the elaboration below.
| Tar2023 (Given Ligand) | CHEMBL503401 (Similar Ligand) |
|---|---|
| Cc3nn(c1ccc(Cl)cc1)c4O/C(O)=C(C#N)\C(c2ccc(Br)cc2Br)c34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCOCCOC2)cc1 |
|
|
|
|
|
|
| 0040c40e 4a008618 60080388 00810618 010c0820 40a04006 02002401 09281600 80240b04 001908c0 19b00004 4000aa40 82004814 20200000 6b820a40 0a3c200c 00410400 82900e0a 00580100 00a60101 c0040100 38018528 20804c80 8f4a0414 00002c04 c0000041 001a0040 70000800 07084b84 1056045a 77060008 8a4204f8 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02002000 28000044 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a8008 10022000 02080000 01400800 01027603 80100120 18280c90 07100040 d9500058 02000400 8000000e 00800000 342000ec 04000600 20060013 80000000 00012670 |