On Target NS5B_HCV1B 0.34020618/CHEMBL3645194
For the given ligand Tar2023, we have found in our database that, being scored 0.34020618, the most similar ligand is CHEMBL3645194. Check out the elaboration below.
| Tar2023 (Given Ligand) | CHEMBL3645194 (Similar Ligand) |
|---|---|
| Cc3nn(c1ccc(Cl)cc1)c4O/C(O)=C(C#N)\C(c2ccc(Br)cc2Br)c34 | CCN(c1cc2nn(-c3ccc(Cl)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 0040c40e 4a008618 60080388 00810618 010c0820 40a04006 02002401 09281600 80240b04 001908c0 19b00004 4000aa40 82004814 20200000 6b820a40 0a3c200c 00410400 82900e0a 00580100 00a60101 c0040100 38018528 20804c80 8f4a0414 00002c04 c0000041 001a0040 70000800 07084b84 1056045a 77060008 8a4204f8 | 0000c006 00805e08 20080902 41310e00 010c0000 00004042 02040000 02001408 00100900 000908c0 09312024 40118800 82008c27 01400201 800a0040 000e200c 04268000 02000604 08600008 00224201 c0100101 1c838f38 20800800 8360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |