On Target NP_HCoV-OC43 0.13168724/CHEMBL3233481
For the given ligand Tar2023, we have found in our database that, being scored 0.13168724, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Tar2023 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc3nn(c1ccc(Cl)cc1)c4O/C(O)=C(C#N)\C(c2ccc(Br)cc2Br)c34 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0040c40e 4a008618 60080388 00810618 010c0820 40a04006 02002401 09281600 80240b04 001908c0 19b00004 4000aa40 82004814 20200000 6b820a40 0a3c200c 00410400 82900e0a 00580100 00a60101 c0040100 38018528 20804c80 8f4a0414 00002c04 c0000041 001a0040 70000800 07084b84 1056045a 77060008 8a4204f8 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |