On Target PLP_SARS 0.21969697/CHEMBL225515
For the given ligand Tar2023, we have found in our database that, being scored 0.21969697, the most similar ligand is CHEMBL225515. Check out the elaboration below.
| Tar2023 (Given Ligand) | CHEMBL225515 (Similar Ligand) |
|---|---|
| Cc3nn(c1ccc(Cl)cc1)c4O/C(O)=C(C#N)\C(c2ccc(Br)cc2Br)c34 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2[nH]1 |
|
|
|
|
|
|
| 0040c40e 4a008618 60080388 00810618 010c0820 40a04006 02002401 09281600 80240b04 001908c0 19b00004 4000aa40 82004814 20200000 6b820a40 0a3c200c 00410400 82900e0a 00580100 00a60101 c0040100 38018528 20804c80 8f4a0414 00002c04 c0000041 001a0040 70000800 07084b84 1056045a 77060008 8a4204f8 | 04008002 00000808 62024108 10010200 00041020 04004044 80080000 01200000 00000300 00000840 00080004 40048800 0680880c 08510002 01030042 020c000c 04028000 02802004 00200008 00020000 40000000 08068b68 b0802002 80c09104 00002c00 80182200 00000200 00000000 00000204 00020001 c0040200 10020000 |