On Target ACE2_HUMAN 0.25882354/CHEMBL400526
For the given ligand aseel, we have found in our database that, being scored 0.25882354, the most similar ligand is CHEMBL400526. Check out the elaboration below.
| aseel (Given Ligand) | CHEMBL400526 (Similar Ligand) |
|---|---|
| c2ccc(C1CCCC1)cc2 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00000000 00400010 00000000 80000000 00000000 00000000 00000002 01020002 00000000 00000400 | 00010000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10000000 02000000 00400008 00000201 00000100 18200e00 03000140 85500018 00000800 80000000 00000000 10000040 04000000 00060003 20004000 03012600 |