On Target DPM_HHV1K 0.15789473/CHEMBL29711
For the given ligand aseel, we have found in our database that, being scored 0.15789473, the most similar ligand is CHEMBL29711. Check out the elaboration below.
| aseel (Given Ligand) | CHEMBL29711 (Similar Ligand) |
|---|---|
| c2ccc(C1CCCC1)cc2 | C[C@]12CC[C@@H](O)[C@@](C)(CO)[C@@H]1CC[C@H]1C[C@@H]3C[C@@]12CC[C@]3(O)CO |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00000000 00400010 00000000 80000000 00000000 00000000 00000002 01020002 00000000 00000400 | 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00800000 00000000 00080008 00000000 00000000 03402000 00000001 00000000 00000000 05000000 00000010 00000000 00000000 00000000 00001000 00000000 01000000 00020000 00000000 |