On Target GP_EBOV 0.24705882/CHEMBL1655
For the given ligand aseel, we have found in our database that, being scored 0.24705882, the most similar ligand is CHEMBL1655. Check out the elaboration below.
| aseel (Given Ligand) | CHEMBL1655 (Similar Ligand) |
|---|---|
| c2ccc(C1CCCC1)cc2 | CN(C)CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00000000 00400010 00000000 80000000 00000000 00000000 00000002 01020002 00000000 00000400 | 04022000 00000008 20000308 00010602 00001080 00000000 82040080 01008400 00000800 00180840 08300500 40018000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040100 12008081 00400010 01000000 a8000000 00522000 40000008 00400280 00060002 04000000 00820600 |