On Target NS5B_HCV1A 0.29069766/CHEMBL175894
For the given ligand aseel, we have found in our database that, being scored 0.29069766, the most similar ligand is CHEMBL175894. Check out the elaboration below.
| aseel (Given Ligand) | CHEMBL175894 (Similar Ligand) |
|---|---|
| c2ccc(C1CCCC1)cc2 | N#Cc1ccc(Br)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000000 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00000000 00000000 02000000 00002000 00000001 00000100 08000000 00000000 00400010 00000000 80000000 00000000 00000000 00000002 01020002 00000000 00000400 | 00056000 01008801 00000102 00010200 00080021 00000000 00000000 00000000 54100900 00880840 08100008 c001d000 04008010 00200000 20000000 08082008 00420000 02001000 04c00008 00008001 00000100 08020a00 11000480 00400014 00000800 80000080 00120000 00000041 10004002 00060402 80000008 08400400 |