On Target DPM_HHV1K 0.1632653/CHEMBL479371
For the given ligand Phenylpyrazolone1, we have found in our database that, being scored 0.1632653, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| Phenylpyrazolone1 (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| C/C2=N/N(c1ccc(Cl)cc1)C(=O)C2 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 0082e006 00000000 00100000 20021600 20000000 04002000 00000001 01004002 00000080 000008c1 0029000c 40009800 06008004 00100000 00020040 00004000 00040000 00001000 08000400 00200a01 c0180000 1c000700 70002800 00200010 00002000 08400002 40080000 10000081 00008000 000e0003 00000000 06020200 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |