On Target PR_HIV1 0.12796208/CHEMBL450294
For the given ligand Phenylpyrazolone1, we have found in our database that, being scored 0.12796208, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Phenylpyrazolone1 (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| C/C2=N/N(c1ccc(Cl)cc1)C(=O)C2 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 0082e006 00000000 00100000 20021600 20000000 04002000 00000001 01004002 00000080 000008c1 0029000c 40009800 06008004 00100000 00020040 00004000 00040000 00001000 08000400 00200a01 c0180000 1c000700 70002800 00200010 00002000 08400002 40080000 10000081 00008000 000e0003 00000000 06020200 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |