On Target E2_HCV77 0.21940929/CHEMBL3908382
For the given ligand Phenylpyrazolone2, we have found in our database that, being scored 0.21940929, the most similar ligand is CHEMBL3908382. Check out the elaboration below.
| Phenylpyrazolone2 (Given Ligand) | CHEMBL3908382 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c2ccc(N1/N=C\CC1=O)cc2 | CC(C)c1ccc2c(Nc3cc(C#Cc4ccc(NC(=O)[C@@H]5CCCN5C(=O)[C@@H](c5ccccc5)N(C)C)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 00826016 00802000 01100000 20b21600 20000010 04000000 00000001 0100401a 00000080 00000841 0029200c 60009000 00008000 00100001 80220040 00004000 00040000 00001000 08000400 00202a00 c0180000 1c000600 70002800 08600018 00000000 08000002 40000000 000000c9 00008000 200e0003 00000000 00010220 | 1001420a 01827a00 001a4920 1c190600 24442020 00006010 00009010 22001808 10002180 00080ad0 08399004 6081b800 07008813 0091a001 c0020440 1a0c0006 04041000 72004000 0860000a 12200201 c1100000 38a48660 20806043 8358001f 00044004 80000200 02a080d0 90800080 0e40830c 01460003 e004e000 200126e0 |