On Target E2_HCV77 0.27118644/CHEMBL4106916
For the given ligand Phenylpyrazolone1, we have found in our database that, being scored 0.27118644, the most similar ligand is CHEMBL4106916. Check out the elaboration below.
| Phenylpyrazolone1 (Given Ligand) | CHEMBL4106916 (Similar Ligand) |
|---|---|
| C/C2=N/N(c1ccc(Cl)cc1)C(=O)C2 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc3c(c2)OCC(=O)N3)c1F |
|
|
|
|
|
|
| 0082e006 00000000 00100000 20021600 20000000 04002000 00000001 01004002 00000080 000008c1 0029000c 40009800 06008004 00100000 00020040 00004000 00040000 00001000 08000400 00200a01 c0180000 1c000700 70002800 00200010 00002000 08400002 40080000 10000081 00008000 000e0003 00000000 06020200 | 0400e042 42000808 20101108 c2010602 80001281 00000010 22000000 01001000 00020800 00080e40 083c0004 4000ca00 02808866 20109084 01005041 28084408 03040200 83000000 08080400 00020201 41100500 18068700 33002000 10428014 00002000 a0000200 28040048 40800081 00008280 00068003 84040000 00020600 |