On Target NS5B_HCV1A 0.26068377/CHEMBL3644924
For the given ligand Phenylpyrazolone2, we have found in our database that, being scored 0.26068377, the most similar ligand is CHEMBL3644924. Check out the elaboration below.
| Phenylpyrazolone2 (Given Ligand) | CHEMBL3644924 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c2ccc(N1/N=C\CC1=O)cc2 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(S(=O)(=O)c2ccc(N3CCCCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00826016 00802000 01100000 20b21600 20000010 04000000 00000001 0100401a 00000080 00000841 0029200c 60009000 00008000 00100001 80220040 00004000 00040000 00001000 08000400 00202a00 c0180000 1c000600 70002800 08600018 00000000 08000002 40000000 000000c9 00008000 200e0003 00000000 00010220 | 00014092 0dc03400 01300100 07b10f00 20080010 0001a000 080a0004 a0003408 10800200 0052a9e8 00202414 f001b400 0e00f002 01042141 80e20440 001a8008 02866014 00082000 48610850 00007603 c0102100 bc050e10 21002003 3a540038 02012000 0002100e 80000000 902004ec 08808600 a1060093 a4184022 01012270 |