On Target NS5B_HCV1B 0.22123894/CHEMBL3645208
For the given ligand Phenylpyrazolone1, we have found in our database that, being scored 0.22123894, the most similar ligand is CHEMBL3645208. Check out the elaboration below.
| Phenylpyrazolone1 (Given Ligand) | CHEMBL3645208 (Similar Ligand) |
|---|---|
| C/C2=N/N(c1ccc(Cl)cc1)C(=O)C2 | CNC(=O)c1c2cc(C3CC3)c(N(CCCO)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 0082e006 00000000 00100000 20021600 20000000 04002000 00000001 01004002 00000080 000008c1 0029000c 40009800 06008004 00100000 00020040 00004000 00040000 00001000 08000400 00200a01 c0180000 1c000700 70002800 00200010 00002000 08400002 40080000 10000081 00008000 000e0003 00000000 06020200 | 0000c006 00805e08 20180902 41310e00 210c0000 00004042 02040000 02001408 00100900 004908c0 09312024 40118800 82008c27 01400201 810a0040 000e200e 04268000 02400604 08e00008 00224205 c0100101 1c838f38 21800880 9360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |