On Target NSP15_SARS 0.16292135/CHEMBL2441741
For the given ligand Phenylpyrazolone2, we have found in our database that, being scored 0.16292135, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Phenylpyrazolone2 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c2ccc(N1/N=C\CC1=O)cc2 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00826016 00802000 01100000 20b21600 20000010 04000000 00000001 0100401a 00000080 00000841 0029200c 60009000 00008000 00100001 80220040 00004000 00040000 00001000 08000400 00202a00 c0180000 1c000600 70002800 08600018 00000000 08000002 40000000 000000c9 00008000 200e0003 00000000 00010220 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |