On Target PLP_SARS 0.27450982/CHEMBL358279
For the given ligand Phenylpyrazolone1, we have found in our database that, being scored 0.27450982, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Phenylpyrazolone1 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| C/C2=N/N(c1ccc(Cl)cc1)C(=O)C2 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0082e006 00000000 00100000 20021600 20000000 04002000 00000001 01004002 00000080 000008c1 0029000c 40009800 06008004 00100000 00020040 00004000 00040000 00001000 08000400 00200a01 c0180000 1c000700 70002800 00200010 00002000 08400002 40080000 10000081 00008000 000e0003 00000000 06020200 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |