On Target NSP1_SARS 0.16374269/CHEMBL2441741
For the given ligand Phenylpyrazolone1, we have found in our database that, being scored 0.16374269, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Phenylpyrazolone1 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C/C2=N/N(c1ccc(Cl)cc1)C(=O)C2 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0082e006 00000000 00100000 20021600 20000000 04002000 00000001 01004002 00000080 000008c1 0029000c 40009800 06008004 00100000 00020040 00004000 00040000 00001000 08000400 00200a01 c0180000 1c000700 70002800 00200010 00002000 08400002 40080000 10000081 00008000 000e0003 00000000 06020200 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |