On Target NS3_HCV1B 0.35/CHEMBL231813
For the given ligand ll, we have found in our database that, being scored 0.35, the most similar ligand is CHEMBL231813. Check out the elaboration below.
| ll (Given Ligand) | CHEMBL231813 (Similar Ligand) |
|---|---|
| C[C@@H](CN3CCC(n2c(=O)[nH]c1ccccc12)CC3)NC(=O)c4ccccc4 | CCC[C@H](NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00000002 01002c00 00100100 04010600 000c0040 00004080 00000000 22001008 04200100 800109e0 0d20800c 50018000 00009802 01c42000 003004c0 000c0004 00100000 02000000 00600000 00000201 c0000000 38028630 21800001 0270001c 00000000 c0000000 00000000 90000000 08000100 00460011 c00c0000 00002280 | 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 20003009 14000000 000101a0 01290000 40013000 0e00801a 01102001 80820400 00040104 08020000 02000003 02002010 00000201 80000000 300f8e30 21004003 02100018 00141000 00000000 08000000 90000004 08000004 01060811 a0024000 80002200 |