On Target DPM_HHV1K 0.2838983/CHEMBL479371
For the given ligand ll, we have found in our database that, being scored 0.2838983, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| ll (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| C[C@@H](CN3CCC(n2c(=O)[nH]c1ccccc12)CC3)NC(=O)c4ccccc4 | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 00000002 01002c00 00100100 04010600 000c0040 00004080 00000000 22001008 04200100 800109e0 0d20800c 50018000 00009802 01c42000 003004c0 000c0004 00100000 02000000 00600000 00000201 c0000000 38028630 21800001 0270001c 00000000 c0000000 00000000 90000000 08000100 00460011 c00c0000 00002280 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |