On Target PR_HIV1 0.24878049/CHEMBL3645129
For the given ligand ll, we have found in our database that, being scored 0.24878049, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| ll (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| C[C@@H](CN3CCC(n2c(=O)[nH]c1ccccc12)CC3)NC(=O)c4ccccc4 | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 00000002 01002c00 00100100 04010600 000c0040 00004080 00000000 22001008 04200100 800109e0 0d20800c 50018000 00009802 01c42000 003004c0 000c0004 00100000 02000000 00600000 00000201 c0000000 38028630 21800001 0270001c 00000000 c0000000 00000000 90000000 08000100 00460011 c00c0000 00002280 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |