On Target NA_INFB 0.33557048/CHEMBL195288
For the given ligand ll, we have found in our database that, being scored 0.33557048, the most similar ligand is CHEMBL195288. Check out the elaboration below.
| ll (Given Ligand) | CHEMBL195288 (Similar Ligand) |
|---|---|
| C[C@@H](CN3CCC(n2c(=O)[nH]c1ccccc12)CC3)NC(=O)c4ccccc4 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ncc[nH]1 |
|
|
|
|
|
|
| 00000002 01002c00 00100100 04010600 000c0040 00004080 00000000 22001008 04200100 800109e0 0d20800c 50018000 00009802 01c42000 003004c0 000c0004 00100000 02000000 00600000 00000201 c0000000 38028630 21800001 0270001c 00000000 c0000000 00000000 90000000 08000100 00460011 c00c0000 00002280 | 0401000a 01003000 00100420 14000400 000800c0 00000010 01000020 20000008 00000100 00000280 00208000 40013000 0600801a 01802001 811a0000 000c000c 10000000 0c000000 00402008 00000201 20100000 30040e30 23000001 02100018 00001000 00000000 00000000 10000180 08000004 00c60801 40024000 20802a00 |