On Target ACE2_HUMAN 0.24705882/CHEMBL404117
For the given ligand MM174, we have found in our database that, being scored 0.24705882, the most similar ligand is CHEMBL404117. Check out the elaboration below.
| MM174 (Given Ligand) | CHEMBL404117 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cn(C)cn1)[C@H]4c2c(CO)c(C)cc2=C(C(C)C)CC[C@H]34 | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@@H](S)C1CCCC1 |
|
|
|
|
|
|
| 00030202 89001000 02110000 00000421 20180040 00002010 00080000 20100c02 01000100 40100088 00388008 41011000 0402900a 00a10000 00000401 000c000c 00000000 00004140 40412000 80202201 80100000 18040610 2100c000 00100018 40200082 00108000 00484610 90000080 00020008 01460401 64021000 02802b00 | 00012000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00200980 020a08c0 08300000 4003b800 0600800a 00040000 80080000 00080008 10020000 02000000 04402008 10000201 00000100 18200e10 13000140 85500018 00000800 80000000 00000000 10000040 04004000 01060003 20024000 03012600 |