On Target ACE2_HUMAN 0.22891566/CHEMBL404117
For the given ligand MM167, we have found in our database that, being scored 0.22891566, the most similar ligand is CHEMBL404117. Check out the elaboration below.
| MM167 (Given Ligand) | CHEMBL404117 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cccs1)[C@H]4c2cc(C)cc2=C(C)CC[C@@H]34 | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@@H](S)C1CCCC1 |
|
|
|
|
|
|
| 00034202 09001000 02100000 00000602 20000000 00002410 00088100 30200412 01000000 0010008a 00280204 61011481 0c02800a 00110000 00020400 00100000 00040000 00000150 48012000 00000201 00100000 58040690 6000a000 00100018 00200080 04010000 00484200 90000484 00000010 010e0401 24020000 02c12200 | 00012000 01005000 00100100 00110600 00000080 00000000 80000000 20000004 00200980 020a08c0 08300000 4003b800 0600800a 00040000 80080000 00080008 10020000 02000000 04402008 10000201 00000100 18200e10 13000140 85500018 00000800 80000000 00000000 10000040 04004000 01060003 20024000 03012600 |