On Target NS3_HCV1B 0.2827381/CHEMBL297884
For the given ligand MM173, we have found in our database that, being scored 0.2827381, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| MM173 (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| CC(C)(C)/C3=C/2CC(=O)/C(c1ccccc1)=C2/[C@H]4[C@H](CC3)/C(=C\CO)C(=O)N4c5cncnc5 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 00030212 09049000 02990302 00010620 60010000 00006011 801800c0 38000402 01000940 405888c8 08380004 41419008 0502811a 20210000 40000403 000c010c 20000400 02000140 40492090 82800201 00100110 18040790 20808060 0050001a 01201082 8830ac00 00486600 d00101a0 00420002 88460403 6c022000 03802680 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |