On Target GP_EBOV 0.26108375/CHEMBL3125897
For the given ligand MM174, we have found in our database that, being scored 0.26108375, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| MM174 (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cn(C)cn1)[C@H]4c2c(CO)c(C)cc2=C(C(C)C)CC[C@H]34 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00030202 89001000 02110000 00000421 20180040 00002010 00080000 20100c02 01000100 40100088 00388008 41011000 0402900a 00a10000 00000401 000c000c 00000000 00004140 40412000 80202201 80100000 18040610 2100c000 00100018 40200082 00108000 00484610 90000080 00020008 01460401 64021000 02802b00 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |