On Target PR_HIV1 0.23664123/CHEMBL492666
For the given ligand MM166, we have found in our database that, being scored 0.23664123, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| MM166 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C=C4C(=O)N(c1cccs1)[C@H]5/C3=C(c2ccccc2)/C(=O)C[C@@]3(O)[C@H](O)CC[C@@H]45 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00074212 89009000 02100b02 00010602 20190000 00002410 80188380 30200412 01000800 005888ca 08380204 60419489 1d02811a 01b10000 40020406 00580108 20040400 02000110 48c12018 02802201 00100100 58140790 6500a0a0 00500018 01201001 8c210400 00486000 d00115a4 00400012 800e0003 2c022000 02c12e00 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |