On Target PR_HIV1 0.1627907/CHEMBL492666
For the given ligand MM167, we have found in our database that, being scored 0.1627907, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| MM167 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cccs1)[C@H]4c2cc(C)cc2=C(C)CC[C@@H]34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00034202 09001000 02100000 00000602 20000000 00002410 00088100 30200412 01000000 0010008a 00280204 61011481 0c02800a 00110000 00020400 00100000 00040000 00000150 48012000 00000201 00100000 58040690 6000a000 00100018 00200080 04010000 00484200 90000484 00000010 010e0401 24020000 02c12200 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |