On Target NS5B_HCV2A 0.23834197/CHEMBL3127326
For the given ligand MM174, we have found in our database that, being scored 0.23834197, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| MM174 (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cn(C)cn1)[C@H]4c2c(CO)c(C)cc2=C(C(C)C)CC[C@H]34 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00030202 89001000 02110000 00000421 20180040 00002010 00080000 20100c02 01000100 40100088 00388008 41011000 0402900a 00a10000 00000401 000c000c 00000000 00004140 40412000 80202201 80100000 18040610 2100c000 00100018 40200082 00108000 00484610 90000080 00020008 01460401 64021000 02802b00 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |