On Target NS5B_HCV2A 0.32608697/CHEMBL3127326
For the given ligand MM166, we have found in our database that, being scored 0.32608697, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| MM166 (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| C=C4C(=O)N(c1cccs1)[C@H]5/C3=C(c2ccccc2)/C(=O)C[C@@]3(O)[C@H](O)CC[C@@H]45 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00074212 89009000 02100b02 00010602 20190000 00002410 80188380 30200412 01000800 005888ca 08380204 60419489 1d02811a 01b10000 40020406 00580108 20040400 02000110 48c12018 02802201 00100100 58140790 6500a0a0 00500018 01201001 8c210400 00486000 d00115a4 00400012 800e0003 2c022000 02c12e00 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |