On Target RT_HIV1 0.42631578/CHEMBL3828596
For the given ligand MM173, we have found in our database that, being scored 0.42631578, the most similar ligand is CHEMBL3828596. Check out the elaboration below.
| MM173 (Given Ligand) | CHEMBL3828596 (Similar Ligand) |
|---|---|
| CC(C)(C)/C3=C/2CC(=O)/C(c1ccccc1)=C2/[C@H]4[C@H](CC3)/C(=C\CO)C(=O)N4c5cncnc5 | C=C(C)[C@@H]1CC[C@]2(CNCCCN3CCCC3=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00030212 09049000 02990302 00010620 60010000 00006011 801800c0 38000402 01000940 405888c8 08380004 41419008 0502811a 20210000 40000403 000c010c 20000400 02000140 40492090 82800201 00100110 18040790 20808060 0050001a 01201082 8830ac00 00486600 d00101a0 00420002 88460403 6c022000 03802680 | 00020000 01001c00 00100302 40050600 00000000 00004010 80000080 20000402 00000900 001809e0 08300000 40019800 04028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 180a0e30 00008020 0050001c 01200000 80000000 00406000 d0000000 00400002 01060013 e4020000 00802600 |