On Target E2_HCV77 0.3211382/CHEMBL3894536
For the given ligand MM173, we have found in our database that, being scored 0.3211382, the most similar ligand is CHEMBL3894536. Check out the elaboration below.
| MM173 (Given Ligand) | CHEMBL3894536 (Similar Ligand) |
|---|---|
| CC(C)(C)/C3=C/2CC(=O)/C(c1ccccc1)=C2/[C@H]4[C@H](CC3)/C(=C\CO)C(=O)N4c5cncnc5 | CC[C@H](NC(=O)C1=CCCNC1)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 00030212 09049000 02990302 00010620 60010000 00006011 801800c0 38000402 01000940 405888c8 08380004 41419008 0502811a 20210000 40000403 000c010c 20000400 02000140 40492090 82800201 00100110 18040790 20808060 0050001a 01201082 8830ac00 00486600 d00101a0 00420002 88460403 6c022000 03802680 | 080080d2 0880dc00 00104100 02010610 00041201 00000010 30182100 03001400 01400800 00180f60 08300004 40009a00 0a008966 00011004 00000400 080c020c 23010200 03000144 00210412 00000201 c0000500 18068780 21808000 3040001c 00043000 e0000200 084c0200 c0800181 00400180 01068413 a4040000 02022600 |