On Target NS5B_HCV1A 0.30481285/CHEMBL3659510
For the given ligand MM174, we have found in our database that, being scored 0.30481285, the most similar ligand is CHEMBL3659510. Check out the elaboration below.
| MM174 (Given Ligand) | CHEMBL3659510 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cn(C)cn1)[C@H]4c2c(CO)c(C)cc2=C(C(C)C)CC[C@H]34 | CCC[C@H](NC(=O)[C@@H]1[C@H]2[C@H]3C=C[C@H](C3)[C@H]2CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00030202 89001000 02110000 00000421 20180040 00002010 00080000 20100c02 01000100 40100088 00388008 41011000 0402900a 00a10000 00000401 000c000c 00000000 00004140 40412000 80202201 80100000 18040610 2100c000 00100018 40200082 00108000 00484610 90000080 00020008 01460401 64021000 02802b00 | 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 2000340b 14000000 001181a0 01290000 40013000 0e02801a 01102001 80820400 00040104 08024000 02000023 02012010 00000201 80000000 300f8e30 2100c003 02100018 00341000 00200000 08404000 90000004 0c000004 01060811 a4024000 80002200 |