On Target NS5B_HCV1A 0.30526316/CHEMBL3644912
For the given ligand MM166, we have found in our database that, being scored 0.30526316, the most similar ligand is CHEMBL3644912. Check out the elaboration below.
| MM166 (Given Ligand) | CHEMBL3644912 (Similar Ligand) |
|---|---|
| C=C4C(=O)N(c1cccs1)[C@H]5/C3=C(c2ccccc2)/C(=O)C[C@@]3(O)[C@H](O)CC[C@@H]45 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(C3CCCCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00074212 89009000 02100b02 00010602 20190000 00002410 80188380 30200412 01000800 005888ca 08380204 60419489 1d02811a 01b10000 40020406 00580108 20040400 02000110 48c12018 02802201 00100100 58140790 6500a0a0 00500018 01201001 8c210400 00486000 d00115a4 00400012 800e0003 2c022000 02c12e00 | 00014086 0d403c00 00100122 45310f00 20080000 00018000 000a0004 a0003409 10800a00 005a8be8 08302404 5001b000 0e00f002 0124a101 80420440 001a8008 02864010 02482000 4a612850 00004a01 60100100 bc050e10 21020003 3244003a 02112000 80001002 00000000 902000ac 08008202 81060093 a41a4000 01016670 |