On Target NS5B_HCV1A 0.31111112/CHEMBL3659510
For the given ligand MM167, we have found in our database that, being scored 0.31111112, the most similar ligand is CHEMBL3659510. Check out the elaboration below.
| MM167 (Given Ligand) | CHEMBL3659510 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cccs1)[C@H]4c2cc(C)cc2=C(C)CC[C@@H]34 | CCC[C@H](NC(=O)[C@@H]1[C@H]2[C@H]3C=C[C@H](C3)[C@H]2CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00034202 09001000 02100000 00000602 20000000 00002410 00088100 30200412 01000000 0010008a 00280204 61011481 0c02800a 00110000 00020400 00100000 00040000 00000150 48012000 00000201 00100000 58040690 6000a000 00100018 00200080 04010000 00484200 90000484 00000010 010e0401 24020000 02c12200 | 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 2000340b 14000000 001181a0 01290000 40013000 0e02801a 01102001 80820400 00040104 08024000 02000023 02012010 00000201 80000000 300f8e30 2100c003 02100018 00341000 00200000 08404000 90000004 0c000004 01060811 a4024000 80002200 |