On Target NS5B_HCV1B 0.20895523/CHEMBL3645202
For the given ligand MM167, we have found in our database that, being scored 0.20895523, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| MM167 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| C=C3C(=O)N(c1cccs1)[C@H]4c2cc(C)cc2=C(C)CC[C@@H]34 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00034202 09001000 02100000 00000602 20000000 00002410 00088100 30200412 01000000 0010008a 00280204 61011481 0c02800a 00110000 00020400 00100000 00040000 00000150 48012000 00000201 00100000 58040690 6000a000 00100018 00200080 04010000 00484200 90000484 00000010 010e0401 24020000 02c12200 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |