On Target NA_INFB 0.43809524/CHEMBL113191
For the given ligand MM166, we have found in our database that, being scored 0.43809524, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| MM166 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| C=C4C(=O)N(c1cccs1)[C@H]5/C3=C(c2ccccc2)/C(=O)C[C@@]3(O)[C@H](O)CC[C@@H]45 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00074212 89009000 02100b02 00010602 20190000 00002410 80188380 30200412 01000800 005888ca 08380204 60419489 1d02811a 01b10000 40020406 00580108 20040400 02000110 48c12018 02802201 00100100 58140790 6500a0a0 00500018 01201001 8c210400 00486000 d00115a4 00400012 800e0003 2c022000 02c12e00 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |